C15H14N6O2S — CID 58010150
2-(1-azidoethyl)-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine (PubChem CID 58010150) has the molecular formula C15H14N6O2S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-(1-azidoethyl)-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine.
| Compound Name | 2-(1-azidoethyl)-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 58010150 |
| Molecular Formula | C15H14N6O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 2-(1-azidoethyl)-5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazine |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3nc(C(C)N=[N+]=[N-])cnc32)cc1 |
| InChI | InChI=1S/C15H14N6O2S/c1-10-3-5-12(6-4-10)24(22,23)21-8-7-13-15(21)17-9-14(18-13)11(2)19-20-16/h3-9,11H,1-2H3 |
| InChIKey | GRGNIHQWTYRQGT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 113.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|