C19H17BrN2O6S — CID 6803764
5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(1,1-dioxothiolan-3-yl)-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 6803764) has the molecular formula C19H17BrN2O6S and a molecular weight of 481.32 g/mol. Its IUPAC name is 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(1,1-dioxothiolan-3-yl)-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(1,1-dioxothiolan-3-yl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6803764 |
| Molecular Formula | C19H17BrN2O6S |
| Molecular Weight | 481.32 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 5-[(3-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-1-(1,1-dioxothiolan-3-yl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COc1cc(C=C2C(=O)N(C3CCS(=O)(=O)C3)C(=O)C(C#N)=C2C)cc(Br)c1O |
| InChI | InChI=1S/C19H17BrN2O6S/c1-10-13(5-11-6-15(20)17(23)16(7-11)28-2)18(24)22(19(25)14(10)8-21)12-3-4-29(26,27)9-12/h5-7,12,23H,3-4,9H2,1-2H3 |
| InChIKey | OJQSSKUONKTPLO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|