C26H32N2O5S — CID 6827495
5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(1,1-dioxothiolan-3-yl)-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 6827495) has the molecular formula C26H32N2O5S and a molecular weight of 484.62 g/mol. Its IUPAC name is 5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(1,1-dioxothiolan-3-yl)-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | 5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(1,1-dioxothiolan-3-yl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6827495 |
| Molecular Formula | C26H32N2O5S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | 5-[(3,5-ditert-butyl-4-hydroxyphenyl)methylidene]-1-(1,1-dioxothiolan-3-yl)-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)N(C2CCS(=O)(=O)C2)C(=O)C1=Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C26H32N2O5S/c1-15-18(10-16-11-20(25(2,3)4)22(29)21(12-16)26(5,6)7)23(30)28(24(31)19(15)13-27)17-8-9-34(32,33)14-17/h10-12,17,29H,8-9,14H2,1-7H3 |
| InChIKey | MWHGDZKSMBDOKA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|