C22H16N2O2 — CID 681703
1-benzoyl-4-phenyl-3H-1,5-benzodiazepin-2-one (PubChem CID 681703) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 1-benzoyl-4-phenyl-3H-1,5-benzodiazepin-2-one.
| Compound Name | 1-benzoyl-4-phenyl-3H-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 681703 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-benzoyl-4-phenyl-3H-1,5-benzodiazepin-2-one |
| SMILES | O=C1CC(c2ccccc2)=Nc2ccccc2N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H16N2O2/c25-21-15-19(16-9-3-1-4-10-16)23-18-13-7-8-14-20(18)24(21)22(26)17-11-5-2-6-12-17/h1-14H,15H2 |
| InChIKey | ODLVSKPTLKUZOG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|