C18H16N2O3 — CID 702388
1-acetyl-5-benzoyl-2,3-dihydro-1,5-benzodiazepin-4-one (PubChem CID 702388) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-acetyl-5-benzoyl-2,3-dihydro-1,5-benzodiazepin-4-one.
| Compound Name | 1-acetyl-5-benzoyl-2,3-dihydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 702388 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-acetyl-5-benzoyl-2,3-dihydro-1,5-benzodiazepin-4-one |
| SMILES | CC(=O)N1CCC(=O)N(C(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H16N2O3/c1-13(21)19-12-11-17(22)20(16-10-6-5-9-15(16)19)18(23)14-7-3-2-4-8-14/h2-10H,11-12H2,1H3 |
| InChIKey | NVSOBVYSQKWGBB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|