C14H16N2O2 — CID 702392
1-acetyl-5-prop-2-enyl-2,3-dihydro-1,5-benzodiazepin-4-one (PubChem CID 702392) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 1-acetyl-5-prop-2-enyl-2,3-dihydro-1,5-benzodiazepin-4-one.
| Compound Name | 1-acetyl-5-prop-2-enyl-2,3-dihydro-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 702392 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 1-acetyl-5-prop-2-enyl-2,3-dihydro-1,5-benzodiazepin-4-one |
| SMILES | C=CCN1C(=O)CCN(C(C)=O)c2ccccc21 |
| InChI | InChI=1S/C14H16N2O2/c1-3-9-16-13-7-5-4-6-12(13)15(11(2)17)10-8-14(16)18/h3-7H,1,8-10H2,2H3 |
| InChIKey | KPOKLIRNGJBGBL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|