C18H15N3O2 — CID 139224777
5-acetyl-6,7-dihydroquinazolino[3,2-a][1,5]benzodiazepin-13-one (PubChem CID 139224777) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 5-acetyl-6,7-dihydroquinazolino[3,2-a][1,5]benzodiazepin-13-one.
| Compound Name | 5-acetyl-6,7-dihydroquinazolino[3,2-a][1,5]benzodiazepin-13-one |
|---|---|
| PubChem CID | 139224777 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 5-acetyl-6,7-dihydroquinazolino[3,2-a][1,5]benzodiazepin-13-one |
| SMILES | CC(=O)N1CCc2nc3ccccc3c(=O)n2-c2ccccc21 |
| InChI | InChI=1S/C18H15N3O2/c1-12(22)20-11-10-17-19-14-7-3-2-6-13(14)18(23)21(17)16-9-5-4-8-15(16)20/h2-9H,10-11H2,1H3 |
| InChIKey | NYWCKYQZCGCJLY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |