C17H19N3O2S — CID 681848
(4aR,8aS)-8a-hydroxy-7,7-dimethyl-2-(3-methylphenyl)-6,8-dihydro-4aH-[1,2,4]triazolo[5,1-b][1,3]benzothiazol-5-one (PubChem CID 681848) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is (4aR,8aS)-8a-hydroxy-7,7-dimethyl-2-(3-methylphenyl)-6,8-dihydro-4aH-[1,2,4]triazolo[5,1-b][1,3]benzothiazol-5-one.
| Compound Name | (4aR,8aS)-8a-hydroxy-7,7-dimethyl-2-(3-methylphenyl)-6,8-dihydro-4aH-[1,2,4]triazolo[5,1-b][1,3]benzothiazol-5-one |
|---|---|
| PubChem CID | 681848 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (4aR,8aS)-8a-hydroxy-7,7-dimethyl-2-(3-methylphenyl)-6,8-dihydro-4aH-[1,2,4]triazolo[5,1-b][1,3]benzothiazol-5-one |
| SMILES | Cc1cccc(-c2nc3n(n2)[C@]2(O)CC(C)(C)CC(=O)[C@@H]2S3)c1 |
| InChI | InChI=1S/C17H19N3O2S/c1-10-5-4-6-11(7-10)14-18-15-20(19-14)17(22)9-16(2,3)8-12(21)13(17)23-15/h4-7,13,22H,8-9H2,1-3H3/t13-,17-/m0/s1 |
| InChIKey | HXQOCRLQDCXBDJ-GUYCJALGSA-N |
| XLogP | 2.76 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |