C11H11FN2O2S — CID 683290
1-(4-fluorophenyl)sulfonyl-3,5-dimethylpyrazole (PubChem CID 683290) has the molecular formula C11H11FN2O2S and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-3,5-dimethylpyrazole.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 683290 |
| Molecular Formula | C11H11FN2O2S |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(S(=O)(=O)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C11H11FN2O2S/c1-8-7-9(2)14(13-8)17(15,16)11-5-3-10(12)4-6-11/h3-7H,1-2H3 |
| InChIKey | KYWSTGXTYOIHRM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |