C11H11N3O4S — CID 747361
3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole (PubChem CID 747361) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is 3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole.
| Compound Name | 3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole |
|---|---|
| PubChem CID | 747361 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 3,5-dimethyl-1-(3-nitrophenyl)sulfonylpyrazole |
| SMILES | Cc1cc(C)n(S(=O)(=O)c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H11N3O4S/c1-8-6-9(2)13(12-8)19(17,18)11-5-3-4-10(7-11)14(15)16/h3-7H,1-2H3 |
| InChIKey | JRDVAFHVPSTDNG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|