C11H12N2O2S — CID 757430
1-(benzenesulfonyl)-3,5-dimethylpyrazole (PubChem CID 757430) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3,5-dimethylpyrazole.
| Compound Name | 1-(benzenesulfonyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 757430 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1-(benzenesulfonyl)-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(S(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C11H12N2O2S/c1-9-8-10(2)13(12-9)16(14,15)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | GNURERHDVMTODN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |