C17H16N2O4S — CID 683339
ethyl 2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)acetate (PubChem CID 683339) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is ethyl 2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)acetate.
| Compound Name | ethyl 2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)acetate |
|---|---|
| PubChem CID | 683339 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | ethyl 2-(N-(1,1-dioxo-1,2-benzothiazol-3-yl)anilino)acetate |
| SMILES | CCOC(=O)CN(C1=NS(=O)(=O)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O4S/c1-2-23-16(20)12-19(13-8-4-3-5-9-13)17-14-10-6-7-11-15(14)24(21,22)18-17/h3-11H,2,12H2,1H3 |
| InChIKey | KWDQNCRHKFJXQV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |