About [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol
[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol (PubChem CID 68500076) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol |
| PubChem CID | 68500076 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol |
| SMILES | OCC1C=CC(CO)O1 |
| InChI | InChI=1S/C6H10O3/c7-3-5-1-2-6(4-8)9-5/h1-2,5-8H,3-4H2 |
| InChIKey | SZGZCHJPYQSARH-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol?
The IUPAC name of [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol (CID 68500076) is [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol.
What is the SMILES notation for [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol?
The canonical SMILES for [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol is OCC1C=CC(CO)O1.
What is the InChIKey of [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol?
The InChIKey is SZGZCHJPYQSARH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3/c7-3-5-1-2-6(4-8)9-5/h1-2,5-8H,3-4H2.
What are the key properties of [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol?
[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol has a molecular weight of 130.14 g/mol, XLogP of -0.71, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol is sourced from PubChem (CID 68500076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).