C6H10O3 — CID 68500076
[5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol (PubChem CID 68500076) has the molecular formula C6H10O3 and a molecular weight of 130.14 g/mol. Its IUPAC name is [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol.
| Compound Name | [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol |
|---|---|
| PubChem CID | 68500076 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | [5-(hydroxymethyl)-2,5-dihydrofuran-2-yl]methanol |
| SMILES | OCC1C=CC(CO)O1 |
| InChI | InChI=1S/C6H10O3/c7-3-5-1-2-6(4-8)9-5/h1-2,5-8H,3-4H2 |
| InChIKey | SZGZCHJPYQSARH-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|