About 3-nitro-2-phenylthiophene;1H-pyrrole
3-nitro-2-phenylthiophene;1H-pyrrole (PubChem CID 68501206) has the molecular formula C14H12N2O2S
and a molecular weight of 272.33 g/mol. Its IUPAC name is 3-nitro-2-phenylthiophene;1H-pyrrole.
Molecular Properties
| Compound Name | 3-nitro-2-phenylthiophene;1H-pyrrole |
| PubChem CID | 68501206 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-nitro-2-phenylthiophene;1H-pyrrole |
| SMILES | O=[N+]([O-])c1ccsc1-c1ccccc1.c1cc[nH]c1 |
| InChI | InChI=1S/C10H7NO2S.C4H5N/c12-11(13)9-6-7-14-10(9)8-4-2-1-3-5-8;1-2-4-5-3-1/h1-7H;1-5H |
| InChIKey | CMBXYYDPKPKKSU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-2-phenylthiophene;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-2-phenylthiophene;1H-pyrrole?
The IUPAC name of 3-nitro-2-phenylthiophene;1H-pyrrole (CID 68501206) is 3-nitro-2-phenylthiophene;1H-pyrrole.
What is the SMILES notation for 3-nitro-2-phenylthiophene;1H-pyrrole?
The canonical SMILES for 3-nitro-2-phenylthiophene;1H-pyrrole is O=[N+]([O-])c1ccsc1-c1ccccc1.c1cc[nH]c1.
What is the InChIKey of 3-nitro-2-phenylthiophene;1H-pyrrole?
The InChIKey is CMBXYYDPKPKKSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2S.C4H5N/c12-11(13)9-6-7-14-10(9)8-4-2-1-3-5-8;1-2-4-5-3-1/h1-7H;1-5H.
What are the key properties of 3-nitro-2-phenylthiophene;1H-pyrrole?
3-nitro-2-phenylthiophene;1H-pyrrole has a molecular weight of 272.33 g/mol, XLogP of 4.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-2-phenylthiophene;1H-pyrrole is sourced from PubChem (CID 68501206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).