About 3-nitrothiophen-2-amine
3-nitrothiophen-2-amine (PubChem CID 3830768) has the molecular formula C4H4N2O2S
and a molecular weight of 144.16 g/mol. Its IUPAC name is 3-nitrothiophen-2-amine.
Molecular Properties
| Compound Name | 3-nitrothiophen-2-amine |
| PubChem CID | 3830768 |
| Molecular Formula | C4H4N2O2S |
| Molecular Weight | 144.16 g/mol |
| Exact Mass | 144.00 |
| IUPAC Name | 3-nitrothiophen-2-amine |
| SMILES | Nc1sccc1[N+](=O)[O-] |
| InChI | InChI=1S/C4H4N2O2S/c5-4-3(6(7)8)1-2-9-4/h1-2H,5H2 |
| InChIKey | OYZHSRJEUNAFRV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrothiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrothiophen-2-amine?
The IUPAC name of 3-nitrothiophen-2-amine (CID 3830768) is 3-nitrothiophen-2-amine.
What is the SMILES notation for 3-nitrothiophen-2-amine?
The canonical SMILES for 3-nitrothiophen-2-amine is Nc1sccc1[N+](=O)[O-].
What is the InChIKey of 3-nitrothiophen-2-amine?
The InChIKey is OYZHSRJEUNAFRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2S/c5-4-3(6(7)8)1-2-9-4/h1-2H,5H2.
What are the key properties of 3-nitrothiophen-2-amine?
3-nitrothiophen-2-amine has a molecular weight of 144.16 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrothiophen-2-amine is sourced from PubChem (CID 3830768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).