C19H14F3N3O4S — CID 68503521
phenyl N-[4-carbamoyl-3-[1-(2,3,6-trifluorophenyl)ethoxy]-1,2-thiazol-5-yl]carbamate (PubChem CID 68503521) has the molecular formula C19H14F3N3O4S and a molecular weight of 437.40 g/mol. Its IUPAC name is phenyl N-[4-carbamoyl-3-[1-(2,3,6-trifluorophenyl)ethoxy]-1,2-thiazol-5-yl]carbamate.
| Compound Name | phenyl N-[4-carbamoyl-3-[1-(2,3,6-trifluorophenyl)ethoxy]-1,2-thiazol-5-yl]carbamate |
|---|---|
| PubChem CID | 68503521 |
| Molecular Formula | C19H14F3N3O4S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | phenyl N-[4-carbamoyl-3-[1-(2,3,6-trifluorophenyl)ethoxy]-1,2-thiazol-5-yl]carbamate |
| SMILES | CC(Oc1nsc(NC(=O)Oc2ccccc2)c1C(N)=O)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C19H14F3N3O4S/c1-9(13-11(20)7-8-12(21)15(13)22)28-17-14(16(23)26)18(30-25-17)24-19(27)29-10-5-3-2-4-6-10/h2-9H,1H3,(H2,23,26)(H,24,27) |
| InChIKey | VIBFGLGKQTVFRD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|