About phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate
phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate (PubChem CID 134096848) has the molecular formula C16H17N3O2S
and a molecular weight of 315.40 g/mol. Its IUPAC name is phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate.
Molecular Properties
| Compound Name | phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate |
| PubChem CID | 134096848 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate |
| SMILES | CCCC(C)c1nsc(NC(=O)Oc2ccccc2)c1C#N |
| InChI | InChI=1S/C16H17N3O2S/c1-3-7-11(2)14-13(10-17)15(22-19-14)18-16(20)21-12-8-5-4-6-9-12/h4-6,8-9,11H,3,7H2,1-2H3,(H,18,20) |
| InChIKey | RCLBLPJQSMHJAN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate?
The IUPAC name of phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate (CID 134096848) is phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate.
What is the SMILES notation for phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate?
The canonical SMILES for phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate is CCCC(C)c1nsc(NC(=O)Oc2ccccc2)c1C#N.
What is the InChIKey of phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate?
The InChIKey is RCLBLPJQSMHJAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2S/c1-3-7-11(2)14-13(10-17)15(22-19-14)18-16(20)21-12-8-5-4-6-9-12/h4-6,8-9,11H,3,7H2,1-2H3,(H,18,20).
What are the key properties of phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate?
phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate has a molecular weight of 315.40 g/mol, XLogP of 4.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-(4-cyano-3-pentan-2-yl-1,2-thiazol-5-yl)carbamate is sourced from PubChem (CID 134096848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).