C11H20 — CID 6850748
trans-(2R,4R)-2-methyl-1-methylidene-4-propan-2-ylcyclohexane (PubChem CID 6850748) has the molecular formula C11H20 and a molecular weight of 152.28 g/mol. Its IUPAC name is trans-(2R,4R)-2-methyl-1-methylidene-4-propan-2-ylcyclohexane.
| Compound Name | trans-(2R,4R)-2-methyl-1-methylidene-4-propan-2-ylcyclohexane |
|---|---|
| PubChem CID | 6850748 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | trans-(2R,4R)-2-methyl-1-methylidene-4-propan-2-ylcyclohexane |
| SMILES | C=C1CC[C@@H](C(C)C)C[C@H]1C |
| InChI | InChI=1S/C11H20/c1-8(2)11-6-5-9(3)10(4)7-11/h8,10-11H,3,5-7H2,1-2,4H3/t10-,11-/m1/s1 |
| InChIKey | WKAIZQNXCIXEBZ-GHMZBOCLSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|