C24H26FNO4 — CID 68511649
4-[[1-[5-(4-fluoro-2-methoxyphenyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoic acid (PubChem CID 68511649) has the molecular formula C24H26FNO4 and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-[[1-[5-(4-fluoro-2-methoxyphenyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoic acid.
| Compound Name | 4-[[1-[5-(4-fluoro-2-methoxyphenyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoic acid |
|---|---|
| PubChem CID | 68511649 |
| Molecular Formula | C24H26FNO4 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-[[1-[5-(4-fluoro-2-methoxyphenyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoic acid |
| SMILES | COc1cc(F)ccc1-c1cc(C(CC(C)C)Nc2ccc(C(=O)O)cc2)c(C)o1 |
| InChI | InChI=1S/C24H26FNO4/c1-14(2)11-21(26-18-8-5-16(6-9-18)24(27)28)20-13-23(30-15(20)3)19-10-7-17(25)12-22(19)29-4/h5-10,12-14,21,26H,11H2,1-4H3,(H,27,28) |
| InChIKey | BDYJMXOQYPRBLW-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |