C24H27NO4 — CID 68512380
4-[[1-[5-(3-methoxyphenyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoic acid (PubChem CID 68512380) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 4-[[1-[5-(3-methoxyphenyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoic acid.
| Compound Name | 4-[[1-[5-(3-methoxyphenyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoic acid |
|---|---|
| PubChem CID | 68512380 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 4-[[1-[5-(3-methoxyphenyl)-2-methylfuran-3-yl]-3-methylbutyl]amino]benzoic acid |
| SMILES | COc1cccc(-c2cc(C(CC(C)C)Nc3ccc(C(=O)O)cc3)c(C)o2)c1 |
| InChI | InChI=1S/C24H27NO4/c1-15(2)12-22(25-19-10-8-17(9-11-19)24(26)27)21-14-23(29-16(21)3)18-6-5-7-20(13-18)28-4/h5-11,13-15,22,25H,12H2,1-4H3,(H,26,27) |
| InChIKey | JEMMJHXGKCVPSX-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |