C20H20N4O4 — CID 68515237
1-[4-(ethylcarbamoyl)-2-phenylmethoxyphenyl]-5-methyltriazole-4-carboxylic acid (PubChem CID 68515237) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 1-[4-(ethylcarbamoyl)-2-phenylmethoxyphenyl]-5-methyltriazole-4-carboxylic acid.
| Compound Name | 1-[4-(ethylcarbamoyl)-2-phenylmethoxyphenyl]-5-methyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 68515237 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 1-[4-(ethylcarbamoyl)-2-phenylmethoxyphenyl]-5-methyltriazole-4-carboxylic acid |
| SMILES | CCNC(=O)c1ccc(-n2nnc(C(=O)O)c2C)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H20N4O4/c1-3-21-19(25)15-9-10-16(24-13(2)18(20(26)27)22-23-24)17(11-15)28-12-14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3,(H,21,25)(H,26,27) |
| InChIKey | JNAIDXJPSDCPBE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |