C23H26FN5O4 — CID 87800448
N-benzyl-1-[4-(ethylcarbamoyl)-2-[2-(2-fluoroethoxy)ethoxy]phenyl]triazole-4-carboxamide (PubChem CID 87800448) has the molecular formula C23H26FN5O4 and a molecular weight of 455.49 g/mol. Its IUPAC name is N-benzyl-1-[4-(ethylcarbamoyl)-2-[2-(2-fluoroethoxy)ethoxy]phenyl]triazole-4-carboxamide.
| Compound Name | N-benzyl-1-[4-(ethylcarbamoyl)-2-[2-(2-fluoroethoxy)ethoxy]phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 87800448 |
| Molecular Formula | C23H26FN5O4 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-benzyl-1-[4-(ethylcarbamoyl)-2-[2-(2-fluoroethoxy)ethoxy]phenyl]triazole-4-carboxamide |
| SMILES | CCNC(=O)c1ccc(-n2cc(C(=O)NCc3ccccc3)nn2)c(OCCOCCF)c1 |
| InChI | InChI=1S/C23H26FN5O4/c1-2-25-22(30)18-8-9-20(21(14-18)33-13-12-32-11-10-24)29-16-19(27-28-29)23(31)26-15-17-6-4-3-5-7-17/h3-9,14,16H,2,10-13,15H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | JMPWDKVOSJOFNZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|