C25H35FN6O4 — CID 69369802
1-[4-(ethylcarbamoyl)-2-(6-fluorohexoxy)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]triazole-4-carboxamide (PubChem CID 69369802) has the molecular formula C25H35FN6O4 and a molecular weight of 502.59 g/mol. Its IUPAC name is 1-[4-(ethylcarbamoyl)-2-(6-fluorohexoxy)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]triazole-4-carboxamide.
| Compound Name | 1-[4-(ethylcarbamoyl)-2-(6-fluorohexoxy)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 69369802 |
| Molecular Formula | C25H35FN6O4 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 1-[4-(ethylcarbamoyl)-2-(6-fluorohexoxy)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]triazole-4-carboxamide |
| SMILES | CCNC(=O)c1ccc(-n2cc(C(=O)NCCCN3CCCC3=O)nn2)c(OCCCCCCF)c1 |
| InChI | InChI=1S/C25H35FN6O4/c1-2-27-24(34)19-10-11-21(22(17-19)36-16-6-4-3-5-12-26)32-18-20(29-30-32)25(35)28-13-8-15-31-14-7-9-23(31)33/h10-11,17-18H,2-9,12-16H2,1H3,(H,27,34)(H,28,35) |
| InChIKey | BYHZRJAJKUHZOI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|