C21H30FN5O4 — CID 69369769
1-[4-(ethylcarbamoyl)-2-(6-fluorohexoxy)phenyl]-N-(1-hydroxypropan-2-yl)triazole-4-carboxamide (PubChem CID 69369769) has the molecular formula C21H30FN5O4 and a molecular weight of 435.50 g/mol. Its IUPAC name is 1-[4-(ethylcarbamoyl)-2-(6-fluorohexoxy)phenyl]-N-(1-hydroxypropan-2-yl)triazole-4-carboxamide.
| Compound Name | 1-[4-(ethylcarbamoyl)-2-(6-fluorohexoxy)phenyl]-N-(1-hydroxypropan-2-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 69369769 |
| Molecular Formula | C21H30FN5O4 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 1-[4-(ethylcarbamoyl)-2-(6-fluorohexoxy)phenyl]-N-(1-hydroxypropan-2-yl)triazole-4-carboxamide |
| SMILES | CCNC(=O)c1ccc(-n2cc(C(=O)NC(C)CO)nn2)c(OCCCCCCF)c1 |
| InChI | InChI=1S/C21H30FN5O4/c1-3-23-20(29)16-8-9-18(19(12-16)31-11-7-5-4-6-10-22)27-13-17(25-26-27)21(30)24-15(2)14-28/h8-9,12-13,15,28H,3-7,10-11,14H2,1-2H3,(H,23,29)(H,24,30) |
| InChIKey | INDKTVRQURGMCK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|