C21H27F4N5O5S — CID 69393217
4-[4-(1,1-dihydroxy-1,3-thiazolidine-3-carbonyl)triazol-1-yl]-3-(6-fluorohexoxy)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 69393217) has the molecular formula C21H27F4N5O5S and a molecular weight of 537.54 g/mol. Its IUPAC name is 4-[4-(1,1-dihydroxy-1,3-thiazolidine-3-carbonyl)triazol-1-yl]-3-(6-fluorohexoxy)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[4-(1,1-dihydroxy-1,3-thiazolidine-3-carbonyl)triazol-1-yl]-3-(6-fluorohexoxy)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 69393217 |
| Molecular Formula | C21H27F4N5O5S |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | 4-[4-(1,1-dihydroxy-1,3-thiazolidine-3-carbonyl)triazol-1-yl]-3-(6-fluorohexoxy)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(-n2cc(C(=O)N3CCS(O)(O)C3)nn2)c(OCCCCCCF)c1 |
| InChI | InChI=1S/C21H27F4N5O5S/c22-7-3-1-2-4-9-35-18-11-15(19(31)26-13-21(23,24)25)5-6-17(18)30-12-16(27-28-30)20(32)29-8-10-36(33,34)14-29/h5-6,11-12,33-34H,1-4,7-10,13-14H2,(H,26,31) |
| InChIKey | KBPDMESIHMNMDO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|