C27H32F3N5O3 — CID 69369118
N-(1-adamantyl)-1-[2-pent-4-enoxy-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide (PubChem CID 69369118) has the molecular formula C27H32F3N5O3 and a molecular weight of 531.58 g/mol. Its IUPAC name is N-(1-adamantyl)-1-[2-pent-4-enoxy-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide.
| Compound Name | N-(1-adamantyl)-1-[2-pent-4-enoxy-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 69369118 |
| Molecular Formula | C27H32F3N5O3 |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.25 |
| IUPAC Name | N-(1-adamantyl)-1-[2-pent-4-enoxy-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide |
| SMILES | C=CCCCOc1cc(C(=O)NCC(F)(F)F)ccc1-n1cc(C(=O)NC23CC4CC(CC(C4)C2)C3)nn1 |
| InChI | InChI=1S/C27H32F3N5O3/c1-2-3-4-7-38-23-11-20(24(36)31-16-27(28,29)30)5-6-22(23)35-15-21(33-34-35)25(37)32-26-12-17-8-18(13-26)10-19(9-17)14-26/h2,5-6,11,15,17-19H,1,3-4,7-10,12-14,16H2,(H,31,36)(H,32,37) |
| InChIKey | SOSLTWCKPCBMOZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|