C21H24FN5O4S — CID 87800570
1-[4-(ethylcarbamoyl)-2-[2-(2-fluoroethoxy)ethoxy]phenyl]-N-(thiophen-2-ylmethyl)triazole-4-carboxamide (PubChem CID 87800570) has the molecular formula C21H24FN5O4S and a molecular weight of 461.52 g/mol. Its IUPAC name is 1-[4-(ethylcarbamoyl)-2-[2-(2-fluoroethoxy)ethoxy]phenyl]-N-(thiophen-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-[4-(ethylcarbamoyl)-2-[2-(2-fluoroethoxy)ethoxy]phenyl]-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 87800570 |
| Molecular Formula | C21H24FN5O4S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-[4-(ethylcarbamoyl)-2-[2-(2-fluoroethoxy)ethoxy]phenyl]-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
| SMILES | CCNC(=O)c1ccc(-n2cc(C(=O)NCc3cccs3)nn2)c(OCCOCCF)c1 |
| InChI | InChI=1S/C21H24FN5O4S/c1-2-23-20(28)15-5-6-18(19(12-15)31-10-9-30-8-7-22)27-14-17(25-26-27)21(29)24-13-16-4-3-11-32-16/h3-6,11-12,14H,2,7-10,13H2,1H3,(H,23,28)(H,24,29) |
| InChIKey | BNYOAUHZDWGBKZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|