C24H27N5O4 — CID 87800049
1-[4-(ethylcarbamoyl)-2-pent-4-enoxyphenyl]-N-phenylmethoxytriazole-4-carboxamide (PubChem CID 87800049) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is 1-[4-(ethylcarbamoyl)-2-pent-4-enoxyphenyl]-N-phenylmethoxytriazole-4-carboxamide.
| Compound Name | 1-[4-(ethylcarbamoyl)-2-pent-4-enoxyphenyl]-N-phenylmethoxytriazole-4-carboxamide |
|---|---|
| PubChem CID | 87800049 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-[4-(ethylcarbamoyl)-2-pent-4-enoxyphenyl]-N-phenylmethoxytriazole-4-carboxamide |
| SMILES | C=CCCCOc1cc(C(=O)NCC)ccc1-n1cc(C(=O)NOCc2ccccc2)nn1 |
| InChI | InChI=1S/C24H27N5O4/c1-3-5-9-14-32-22-15-19(23(30)25-4-2)12-13-21(22)29-16-20(26-28-29)24(31)27-33-17-18-10-7-6-8-11-18/h3,6-8,10-13,15-16H,1,4-5,9,14,17H2,2H3,(H,25,30)(H,27,31) |
| InChIKey | WCABLRLEOTURMX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|