C23H30N6O4 — CID 69368869
1-[4-(ethylcarbamoyl)-2-pent-4-enoxyphenyl]-N-(2-oxoazepan-3-yl)triazole-4-carboxamide (PubChem CID 69368869) has the molecular formula C23H30N6O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-[4-(ethylcarbamoyl)-2-pent-4-enoxyphenyl]-N-(2-oxoazepan-3-yl)triazole-4-carboxamide.
| Compound Name | 1-[4-(ethylcarbamoyl)-2-pent-4-enoxyphenyl]-N-(2-oxoazepan-3-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 69368869 |
| Molecular Formula | C23H30N6O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 1-[4-(ethylcarbamoyl)-2-pent-4-enoxyphenyl]-N-(2-oxoazepan-3-yl)triazole-4-carboxamide |
| SMILES | C=CCCCOc1cc(C(=O)NCC)ccc1-n1cc(C(=O)NC2CCCCNC2=O)nn1 |
| InChI | InChI=1S/C23H30N6O4/c1-3-5-8-13-33-20-14-16(21(30)24-4-2)10-11-19(20)29-15-18(27-28-29)23(32)26-17-9-6-7-12-25-22(17)31/h3,10-11,14-15,17H,1,4-9,12-13H2,2H3,(H,24,30)(H,25,31)(H,26,32) |
| InChIKey | CRMOARNGLQYJTP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|