C23H29F4N5O3 — CID 69369215
N-cyclopentyl-1-[2-(6-fluorohexoxy)-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide (PubChem CID 69369215) has the molecular formula C23H29F4N5O3 and a molecular weight of 499.51 g/mol. Its IUPAC name is N-cyclopentyl-1-[2-(6-fluorohexoxy)-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide.
| Compound Name | N-cyclopentyl-1-[2-(6-fluorohexoxy)-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 69369215 |
| Molecular Formula | C23H29F4N5O3 |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | N-cyclopentyl-1-[2-(6-fluorohexoxy)-4-(2,2,2-trifluoroethylcarbamoyl)phenyl]triazole-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(-n2cc(C(=O)NC3CCCC3)nn2)c(OCCCCCCF)c1 |
| InChI | InChI=1S/C23H29F4N5O3/c24-11-5-1-2-6-12-35-20-13-16(21(33)28-15-23(25,26)27)9-10-19(20)32-14-18(30-31-32)22(34)29-17-7-3-4-8-17/h9-10,13-14,17H,1-8,11-12,15H2,(H,28,33)(H,29,34) |
| InChIKey | ZPZRDOZZSYXTEN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|