C30H33F2N3O4 — CID 68518846
[2-[7-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4-nitrophenyl)propyl] N-tert-butylcarbamate (PubChem CID 68518846) has the molecular formula C30H33F2N3O4 and a molecular weight of 537.61 g/mol. Its IUPAC name is [2-[7-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4-nitrophenyl)propyl] N-tert-butylcarbamate.
| Compound Name | [2-[7-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4-nitrophenyl)propyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 68518846 |
| Molecular Formula | C30H33F2N3O4 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | [2-[7-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4-nitrophenyl)propyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCC(Cc1ccc([N+](=O)[O-])cc1)N1Cc2cc(F)ccc2CC1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C30H33F2N3O4/c1-30(2,3)33-29(36)39-19-28(15-21-6-12-26(13-7-21)35(37)38)34-18-23-16-25(32)11-8-22(23)17-27(34)14-20-4-9-24(31)10-5-20/h4-13,16,27-28H,14-15,17-19H2,1-3H3,(H,33,36) |
| InChIKey | GNPVCQLCRCLIGZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|