C27H25F2N3O3 — CID 59323053
3-ethenyl-N-[2-[6-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-5-nitrobenzamide (PubChem CID 59323053) has the molecular formula C27H25F2N3O3 and a molecular weight of 477.51 g/mol. Its IUPAC name is 3-ethenyl-N-[2-[6-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-5-nitrobenzamide.
| Compound Name | 3-ethenyl-N-[2-[6-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 59323053 |
| Molecular Formula | C27H25F2N3O3 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 3-ethenyl-N-[2-[6-fluoro-3-[(4-fluorophenyl)methyl]-3,4-dihydro-1H-isoquinolin-2-yl]ethyl]-5-nitrobenzamide |
| SMILES | C=Cc1cc(C(=O)NCCN2Cc3ccc(F)cc3CC2Cc2ccc(F)cc2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H25F2N3O3/c1-2-18-11-22(16-26(12-18)32(34)35)27(33)30-9-10-31-17-20-5-8-24(29)14-21(20)15-25(31)13-19-3-6-23(28)7-4-19/h2-8,11-12,14,16,25H,1,9-10,13,15,17H2,(H,30,33) |
| InChIKey | ATSBTGDYKIKNDI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|