C24H29ClN2O4 — CID 68520213
6-methoxy-2-methyl-3-(2-morpholin-4-ylethoxymethyl)-4-phenylisoquinolin-1-one;hydrochloride (PubChem CID 68520213) has the molecular formula C24H29ClN2O4 and a molecular weight of 444.96 g/mol. Its IUPAC name is 6-methoxy-2-methyl-3-(2-morpholin-4-ylethoxymethyl)-4-phenylisoquinolin-1-one;hydrochloride.
| Compound Name | 6-methoxy-2-methyl-3-(2-morpholin-4-ylethoxymethyl)-4-phenylisoquinolin-1-one;hydrochloride |
|---|---|
| PubChem CID | 68520213 |
| Molecular Formula | C24H29ClN2O4 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 6-methoxy-2-methyl-3-(2-morpholin-4-ylethoxymethyl)-4-phenylisoquinolin-1-one;hydrochloride |
| SMILES | COc1ccc2c(=O)n(C)c(COCCN3CCOCC3)c(-c3ccccc3)c2c1.Cl |
| InChI | InChI=1S/C24H28N2O4.ClH/c1-25-22(17-30-15-12-26-10-13-29-14-11-26)23(18-6-4-3-5-7-18)21-16-19(28-2)8-9-20(21)24(25)27;/h3-9,16H,10-15,17H2,1-2H3;1H |
| InChIKey | CGOHFXOSNSIYCP-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|