C21H24BrN6O3S+ — CID 68520646
1-[4-[2-[9-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-ium-9-yl]ethyl]piperidin-1-yl]ethanone (PubChem CID 68520646) has the molecular formula C21H24BrN6O3S+ and a molecular weight of 520.43 g/mol. Its IUPAC name is 1-[4-[2-[9-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-ium-9-yl]ethyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[9-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-ium-9-yl]ethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 68520646 |
| Molecular Formula | C21H24BrN6O3S+ |
| Molecular Weight | 520.43 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | 1-[4-[2-[9-amino-8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]purin-9-ium-9-yl]ethyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(CC[N+]2(N)C(Sc3cc4c(cc3Br)OCO4)=Nc3cncnc32)CC1 |
| InChI | InChI=1S/C21H24BrN6O3S/c1-13(29)27-5-2-14(3-6-27)4-7-28(23)20-16(10-24-11-25-20)26-21(28)32-19-9-18-17(8-15(19)22)30-12-31-18/h8-11,14H,2-7,12,23H2,1H3/q+1 |
| InChIKey | BTZRDENTIHINAZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|