C24H18F5NO2 — CID 68522139
(2R)-N-(2-fluorophenyl)-2-[4-(1,3,3,3-tetrafluoro-2-phenylprop-1-enyl)phenoxy]propanamide (PubChem CID 68522139) has the molecular formula C24H18F5NO2 and a molecular weight of 447.40 g/mol. Its IUPAC name is (2R)-N-(2-fluorophenyl)-2-[4-(1,3,3,3-tetrafluoro-2-phenylprop-1-enyl)phenoxy]propanamide.
| Compound Name | (2R)-N-(2-fluorophenyl)-2-[4-(1,3,3,3-tetrafluoro-2-phenylprop-1-enyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 68522139 |
| Molecular Formula | C24H18F5NO2 |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (2R)-N-(2-fluorophenyl)-2-[4-(1,3,3,3-tetrafluoro-2-phenylprop-1-enyl)phenoxy]propanamide |
| SMILES | C[C@@H](Oc1ccc(C(F)=C(c2ccccc2)C(F)(F)F)cc1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C24H18F5NO2/c1-15(23(31)30-20-10-6-5-9-19(20)25)32-18-13-11-17(12-14-18)22(26)21(24(27,28)29)16-7-3-2-4-8-16/h2-15H,1H3,(H,30,31)/t15-/m1/s1 |
| InChIKey | WIQSQUBBECKHOK-OAHLLOKOSA-N |
| XLogP | 6.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|