C26H27N3O2 — CID 68523179
3-[1-[5-(dimethylamino)-2-pyridinyl]-3-(2-phenylethyl)indol-5-yl]propanoic acid (PubChem CID 68523179) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-[1-[5-(dimethylamino)-2-pyridinyl]-3-(2-phenylethyl)indol-5-yl]propanoic acid.
| Compound Name | 3-[1-[5-(dimethylamino)-2-pyridinyl]-3-(2-phenylethyl)indol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 68523179 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 3-[1-[5-(dimethylamino)-2-pyridinyl]-3-(2-phenylethyl)indol-5-yl]propanoic acid |
| SMILES | CN(C)c1ccc(-n2cc(CCc3ccccc3)c3cc(CCC(=O)O)ccc32)nc1 |
| InChI | InChI=1S/C26H27N3O2/c1-28(2)22-12-14-25(27-17-22)29-18-21(11-8-19-6-4-3-5-7-19)23-16-20(9-13-24(23)29)10-15-26(30)31/h3-7,9,12-14,16-18H,8,10-11,15H2,1-2H3,(H,30,31) |
| InChIKey | BFVOEOCWDKSKSY-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |