C29H32N2O2 — CID 68523558
ethyl 3-[1-[3-(dimethylamino)phenyl]-3-(2-phenylethyl)indol-5-yl]propanoate (PubChem CID 68523558) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is ethyl 3-[1-[3-(dimethylamino)phenyl]-3-(2-phenylethyl)indol-5-yl]propanoate.
| Compound Name | ethyl 3-[1-[3-(dimethylamino)phenyl]-3-(2-phenylethyl)indol-5-yl]propanoate |
|---|---|
| PubChem CID | 68523558 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | ethyl 3-[1-[3-(dimethylamino)phenyl]-3-(2-phenylethyl)indol-5-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc2c(c1)c(CCc1ccccc1)cn2-c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C29H32N2O2/c1-4-33-29(32)18-15-23-14-17-28-27(19-23)24(16-13-22-9-6-5-7-10-22)21-31(28)26-12-8-11-25(20-26)30(2)3/h5-12,14,17,19-21H,4,13,15-16,18H2,1-3H3 |
| InChIKey | DFBUOJLCABMBDV-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |