C30H33NO4 — CID 68519103
ethyl 3-[1-[4-(3-hydroxypropoxy)phenyl]-3-(2-phenylethyl)indol-5-yl]propanoate (PubChem CID 68519103) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is ethyl 3-[1-[4-(3-hydroxypropoxy)phenyl]-3-(2-phenylethyl)indol-5-yl]propanoate.
| Compound Name | ethyl 3-[1-[4-(3-hydroxypropoxy)phenyl]-3-(2-phenylethyl)indol-5-yl]propanoate |
|---|---|
| PubChem CID | 68519103 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | ethyl 3-[1-[4-(3-hydroxypropoxy)phenyl]-3-(2-phenylethyl)indol-5-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc2c(c1)c(CCc1ccccc1)cn2-c1ccc(OCCCO)cc1 |
| InChI | InChI=1S/C30H33NO4/c1-2-34-30(33)18-11-24-10-17-29-28(21-24)25(12-9-23-7-4-3-5-8-23)22-31(29)26-13-15-27(16-14-26)35-20-6-19-32/h3-5,7-8,10,13-17,21-22,32H,2,6,9,11-12,18-20H2,1H3 |
| InChIKey | HUCJPHRLPOOATN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|