C29H29NO4 — CID 59317776
ethyl (E)-3-[1-[4-(2-hydroxyethoxy)phenyl]-3-(2-phenylethyl)indol-5-yl]prop-2-enoate (PubChem CID 59317776) has the molecular formula C29H29NO4 and a molecular weight of 455.55 g/mol. Its IUPAC name is ethyl (E)-3-[1-[4-(2-hydroxyethoxy)phenyl]-3-(2-phenylethyl)indol-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[1-[4-(2-hydroxyethoxy)phenyl]-3-(2-phenylethyl)indol-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 59317776 |
| Molecular Formula | C29H29NO4 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | ethyl (E)-3-[1-[4-(2-hydroxyethoxy)phenyl]-3-(2-phenylethyl)indol-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1ccc2c(c1)c(CCc1ccccc1)cn2-c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C29H29NO4/c1-2-33-29(32)17-10-23-9-16-28-27(20-23)24(11-8-22-6-4-3-5-7-22)21-30(28)25-12-14-26(15-13-25)34-19-18-31/h3-7,9-10,12-17,20-21,31H,2,8,11,18-19H2,1H3/b17-10+ |
| InChIKey | LKNJIMLHIRGKOH-LICLKQGHSA-N |
| XLogP | 5.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|