C34H31NO4 — CID 68521958
3-[3-(2-phenylethyl)-1-[4-(2-phenylmethoxyethoxy)phenyl]indol-5-yl]prop-2-enoic acid (PubChem CID 68521958) has the molecular formula C34H31NO4 and a molecular weight of 517.63 g/mol. Its IUPAC name is 3-[3-(2-phenylethyl)-1-[4-(2-phenylmethoxyethoxy)phenyl]indol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[3-(2-phenylethyl)-1-[4-(2-phenylmethoxyethoxy)phenyl]indol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68521958 |
| Molecular Formula | C34H31NO4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | 3-[3-(2-phenylethyl)-1-[4-(2-phenylmethoxyethoxy)phenyl]indol-5-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc2c(c1)c(CCc1ccccc1)cn2-c1ccc(OCCOCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H31NO4/c36-34(37)20-13-27-12-19-33-32(23-27)29(14-11-26-7-3-1-4-8-26)24-35(33)30-15-17-31(18-16-30)39-22-21-38-25-28-9-5-2-6-10-28/h1-10,12-13,15-20,23-24H,11,14,21-22,25H2,(H,36,37) |
| InChIKey | ZSIPIRNBGDXDDS-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|