C29H30N2O3 — CID 68519157
ethyl 3-[1-(2-acetamidophenyl)-3-(2-phenylethyl)indol-5-yl]propanoate (PubChem CID 68519157) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is ethyl 3-[1-(2-acetamidophenyl)-3-(2-phenylethyl)indol-5-yl]propanoate.
| Compound Name | ethyl 3-[1-(2-acetamidophenyl)-3-(2-phenylethyl)indol-5-yl]propanoate |
|---|---|
| PubChem CID | 68519157 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | ethyl 3-[1-(2-acetamidophenyl)-3-(2-phenylethyl)indol-5-yl]propanoate |
| SMILES | CCOC(=O)CCc1ccc2c(c1)c(CCc1ccccc1)cn2-c1ccccc1NC(C)=O |
| InChI | InChI=1S/C29H30N2O3/c1-3-34-29(33)18-15-23-14-17-27-25(19-23)24(16-13-22-9-5-4-6-10-22)20-31(27)28-12-8-7-11-26(28)30-21(2)32/h4-12,14,17,19-20H,3,13,15-16,18H2,1-2H3,(H,30,32) |
| InChIKey | LOWREMQPDJADDV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |