C26H22N2O2 — CID 68523187
3-[1-(3-cyanophenyl)-3-(2-phenylethyl)indol-5-yl]propanoic acid (PubChem CID 68523187) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 3-[1-(3-cyanophenyl)-3-(2-phenylethyl)indol-5-yl]propanoic acid.
| Compound Name | 3-[1-(3-cyanophenyl)-3-(2-phenylethyl)indol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 68523187 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 3-[1-(3-cyanophenyl)-3-(2-phenylethyl)indol-5-yl]propanoic acid |
| SMILES | N#Cc1cccc(-n2cc(CCc3ccccc3)c3cc(CCC(=O)O)ccc32)c1 |
| InChI | InChI=1S/C26H22N2O2/c27-17-21-7-4-8-23(15-21)28-18-22(12-9-19-5-2-1-3-6-19)24-16-20(10-13-25(24)28)11-14-26(29)30/h1-8,10,13,15-16,18H,9,11-12,14H2,(H,29,30) |
| InChIKey | JUHQEYPQGWIWLZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |