C22H24F2N4O5 — CID 68525274
[1-[1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate (PubChem CID 68525274) has the molecular formula C22H24F2N4O5 and a molecular weight of 462.45 g/mol. Its IUPAC name is [1-[1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate.
| Compound Name | [1-[1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68525274 |
| Molecular Formula | C22H24F2N4O5 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | [1-[1-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]piperidin-4-yl]benzotriazol-5-yl] hydrogen carbonate |
| SMILES | CCOc1cc(CN2CCC(n3nnc4cc(OC(=O)O)ccc43)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C22H24F2N4O5/c1-2-31-20-11-14(3-6-19(20)33-21(23)24)13-27-9-7-15(8-10-27)28-18-5-4-16(32-22(29)30)12-17(18)25-26-28/h3-6,11-12,15,21H,2,7-10,13H2,1H3,(H,29,30) |
| InChIKey | QSJSCCZQDJIRRK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|