C18H10O5 — CID 68526905
3-(2-naphthalen-1-ylethynyl)furan-2,5-dicarboxylic acid (PubChem CID 68526905) has the molecular formula C18H10O5 and a molecular weight of 306.27 g/mol. Its IUPAC name is 3-(2-naphthalen-1-ylethynyl)furan-2,5-dicarboxylic acid.
| Compound Name | 3-(2-naphthalen-1-ylethynyl)furan-2,5-dicarboxylic acid |
|---|---|
| PubChem CID | 68526905 |
| Molecular Formula | C18H10O5 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 3-(2-naphthalen-1-ylethynyl)furan-2,5-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C#Cc2cccc3ccccc23)c(C(=O)O)o1 |
| InChI | InChI=1S/C18H10O5/c19-17(20)15-10-13(16(23-15)18(21)22)9-8-12-6-3-5-11-4-1-2-7-14(11)12/h1-7,10H,(H,19,20)(H,21,22) |
| InChIKey | IBRCVOFWRJTYEX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|