C23H24FN3O3 — CID 68527403
N-ethyl-6-[4-(4-fluorophenoxy)phenyl]-4-methoxy-N',N'-dimethylpyridine-2-carbohydrazide (PubChem CID 68527403) has the molecular formula C23H24FN3O3 and a molecular weight of 409.46 g/mol. Its IUPAC name is N-ethyl-6-[4-(4-fluorophenoxy)phenyl]-4-methoxy-N',N'-dimethylpyridine-2-carbohydrazide.
| Compound Name | N-ethyl-6-[4-(4-fluorophenoxy)phenyl]-4-methoxy-N',N'-dimethylpyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 68527403 |
| Molecular Formula | C23H24FN3O3 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-ethyl-6-[4-(4-fluorophenoxy)phenyl]-4-methoxy-N',N'-dimethylpyridine-2-carbohydrazide |
| SMILES | CCN(C(=O)c1cc(OC)cc(-c2ccc(Oc3ccc(F)cc3)cc2)n1)N(C)C |
| InChI | InChI=1S/C23H24FN3O3/c1-5-27(26(2)3)23(28)22-15-20(29-4)14-21(25-22)16-6-10-18(11-7-16)30-19-12-8-17(24)9-13-19/h6-15H,5H2,1-4H3 |
| InChIKey | NSLHDXLIFADCLQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|