C29H35N3O2 — CID 68528904
1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[(1-phenylcyclohexyl)methyl]urea (PubChem CID 68528904) has the molecular formula C29H35N3O2 and a molecular weight of 457.62 g/mol. Its IUPAC name is 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[(1-phenylcyclohexyl)methyl]urea.
| Compound Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[(1-phenylcyclohexyl)methyl]urea |
|---|---|
| PubChem CID | 68528904 |
| Molecular Formula | C29H35N3O2 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.27 |
| IUPAC Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[(1-phenylcyclohexyl)methyl]urea |
| SMILES | CC(C)(C)c1ccccc1Oc1ncccc1NC(=O)NCC1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C29H35N3O2/c1-28(2,3)23-15-8-9-17-25(23)34-26-24(16-12-20-30-26)32-27(33)31-21-29(18-10-5-11-19-29)22-13-6-4-7-14-22/h4,6-9,12-17,20H,5,10-11,18-19,21H2,1-3H3,(H2,31,32,33) |
| InChIKey | ZXDIKIPOMVVVTE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |