C14H17N3S — CID 68531662
4-(4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-ylmethyl)aniline (PubChem CID 68531662) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 4-(4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-ylmethyl)aniline.
| Compound Name | 4-(4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-ylmethyl)aniline |
|---|---|
| PubChem CID | 68531662 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 4-(4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepin-6-ylmethyl)aniline |
| SMILES | Nc1ccc(CN2CCc3ncsc3CC2)cc1 |
| InChI | InChI=1S/C14H17N3S/c15-12-3-1-11(2-4-12)9-17-7-5-13-14(6-8-17)18-10-16-13/h1-4,10H,5-9,15H2 |
| InChIKey | RXCPWBWDGCMNMP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|