C32H42N4O3 — CID 68531771
1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-(3-methyl-1-piperidin-4-ylbutoxy)phenyl]urea (PubChem CID 68531771) has the molecular formula C32H42N4O3 and a molecular weight of 530.71 g/mol. Its IUPAC name is 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-(3-methyl-1-piperidin-4-ylbutoxy)phenyl]urea.
| Compound Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-(3-methyl-1-piperidin-4-ylbutoxy)phenyl]urea |
|---|---|
| PubChem CID | 68531771 |
| Molecular Formula | C32H42N4O3 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | 1-[2-(2-tert-butylphenoxy)-3-pyridinyl]-3-[4-(3-methyl-1-piperidin-4-ylbutoxy)phenyl]urea |
| SMILES | CC(C)CC(Oc1ccc(NC(=O)Nc2cccnc2Oc2ccccc2C(C)(C)C)cc1)C1CCNCC1 |
| InChI | InChI=1S/C32H42N4O3/c1-22(2)21-29(23-16-19-33-20-17-23)38-25-14-12-24(13-15-25)35-31(37)36-27-10-8-18-34-30(27)39-28-11-7-6-9-26(28)32(3,4)5/h6-15,18,22-23,29,33H,16-17,19-21H2,1-5H3,(H2,35,36,37) |
| InChIKey | HXGYKQWONYQMDQ-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |