C15H17N3S2 — CID 68532199
2-[4-[3-(4-methylthiophen-2-yl)prop-2-ynyl]piperazin-1-yl]-1,3-thiazole (PubChem CID 68532199) has the molecular formula C15H17N3S2 and a molecular weight of 303.46 g/mol. Its IUPAC name is 2-[4-[3-(4-methylthiophen-2-yl)prop-2-ynyl]piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-[3-(4-methylthiophen-2-yl)prop-2-ynyl]piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 68532199 |
| Molecular Formula | C15H17N3S2 |
| Molecular Weight | 303.46 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[4-[3-(4-methylthiophen-2-yl)prop-2-ynyl]piperazin-1-yl]-1,3-thiazole |
| SMILES | Cc1csc(C#CCN2CCN(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C15H17N3S2/c1-13-11-14(20-12-13)3-2-5-17-6-8-18(9-7-17)15-16-4-10-19-15/h4,10-12H,5-9H2,1H3 |
| InChIKey | ZHUJKFIMKDOUSP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|