C18H22ClN3S — CID 68533517
2-[3-methyl-4-[3-(3-methylphenyl)prop-2-ynyl]piperazin-1-yl]-1,3-thiazole;hydrochloride (PubChem CID 68533517) has the molecular formula C18H22ClN3S and a molecular weight of 347.92 g/mol. Its IUPAC name is 2-[3-methyl-4-[3-(3-methylphenyl)prop-2-ynyl]piperazin-1-yl]-1,3-thiazole;hydrochloride.
| Compound Name | 2-[3-methyl-4-[3-(3-methylphenyl)prop-2-ynyl]piperazin-1-yl]-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 68533517 |
| Molecular Formula | C18H22ClN3S |
| Molecular Weight | 347.92 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-[3-methyl-4-[3-(3-methylphenyl)prop-2-ynyl]piperazin-1-yl]-1,3-thiazole;hydrochloride |
| SMILES | Cc1cccc(C#CCN2CCN(c3nccs3)CC2C)c1.Cl |
| InChI | InChI=1S/C18H21N3S.ClH/c1-15-5-3-6-17(13-15)7-4-9-20-10-11-21(14-16(20)2)18-19-8-12-22-18;/h3,5-6,8,12-13,16H,9-11,14H2,1-2H3;1H |
| InChIKey | VWLDCGFLYYJGPZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.92 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|